About 4-[2-[cyclopropyl(methyl)amino]ethoxy]-1H-pyrazolo[5,4-d]pyrimidin-6-amine
4-[2-[cyclopropyl(methyl)amino]ethoxy]-1H-pyrazolo[5,4-d]pyrimidin-6-amine (PubChem CID 102741163) has the molecular formula C11H16N6O
and a molecular weight of 248.29 g/mol. Its IUPAC name is 4-[2-[cyclopropyl(methyl)amino]ethoxy]-1H-pyrazolo[5,4-d]pyrimidin-6-amine.
Molecular Properties
| Compound Name | 4-[2-[cyclopropyl(methyl)amino]ethoxy]-1H-pyrazolo[5,4-d]pyrimidin-6-amine |
| PubChem CID | 102741163 |
| Molecular Formula | C11H16N6O |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 4-[2-[cyclopropyl(methyl)amino]ethoxy]-1H-pyrazolo[5,4-d]pyrimidin-6-amine |
| SMILES | CN(CCOc1nc(N)nc2[nH]ncc12)C1CC1 |
| InChI | InChI=1S/C11H16N6O/c1-17(7-2-3-7)4-5-18-10-8-6-13-16-9(8)14-11(12)15-10/h6-7H,2-5H2,1H3,(H3,12,13,14,15,16) |
| InChIKey | QIOXDZJZLNUOJN-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[2-[cyclopropyl(methyl)amino]ethoxy]-1H-pyrazolo[5,4-d]pyrimidin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[cyclopropyl(methyl)amino]ethoxy]-1H-pyrazolo[5,4-d]pyrimidin-6-amine?
The IUPAC name of 4-[2-[cyclopropyl(methyl)amino]ethoxy]-1H-pyrazolo[5,4-d]pyrimidin-6-amine (CID 102741163) is 4-[2-[cyclopropyl(methyl)amino]ethoxy]-1H-pyrazolo[5,4-d]pyrimidin-6-amine.
What is the SMILES notation for 4-[2-[cyclopropyl(methyl)amino]ethoxy]-1H-pyrazolo[5,4-d]pyrimidin-6-amine?
The canonical SMILES for 4-[2-[cyclopropyl(methyl)amino]ethoxy]-1H-pyrazolo[5,4-d]pyrimidin-6-amine is CN(CCOc1nc(N)nc2[nH]ncc12)C1CC1.
What is the InChIKey of 4-[2-[cyclopropyl(methyl)amino]ethoxy]-1H-pyrazolo[5,4-d]pyrimidin-6-amine?
The InChIKey is QIOXDZJZLNUOJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N6O/c1-17(7-2-3-7)4-5-18-10-8-6-13-16-9(8)14-11(12)15-10/h6-7H,2-5H2,1H3,(H3,12,13,14,15,16).
What are the key properties of 4-[2-[cyclopropyl(methyl)amino]ethoxy]-1H-pyrazolo[5,4-d]pyrimidin-6-amine?
4-[2-[cyclopropyl(methyl)amino]ethoxy]-1H-pyrazolo[5,4-d]pyrimidin-6-amine has a molecular weight of 248.29 g/mol, XLogP of 0.41, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[cyclopropyl(methyl)amino]ethoxy]-1H-pyrazolo[5,4-d]pyrimidin-6-amine is sourced from PubChem (CID 102741163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).