C10H21N5O — CID 102744287
N-(diaminomethylidene)-2,2,6,6-tetramethylmorpholine-4-carboximidamide (PubChem CID 102744287) has the molecular formula C10H21N5O and a molecular weight of 227.31 g/mol. Its IUPAC name is N-(diaminomethylidene)-2,2,6,6-tetramethylmorpholine-4-carboximidamide.
| Compound Name | N-(diaminomethylidene)-2,2,6,6-tetramethylmorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 102744287 |
| Molecular Formula | C10H21N5O |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | N-(diaminomethylidene)-2,2,6,6-tetramethylmorpholine-4-carboximidamide |
| SMILES | [H]/N=C(\N=C(N)N)N1CC(C)(C)OC(C)(C)C1 |
| InChI | InChI=1S/C10H21N5O/c1-9(2)5-15(6-10(3,4)16-9)8(13)14-7(11)12/h5-6H2,1-4H3,(H5,11,12,13,14) |
| InChIKey | DTHDLFLYEWDIHF-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|