C12H18IN3O — CID 102745301
4-(5-iodopyrimidin-4-yl)-2,2,6,6-tetramethylmorpholine (PubChem CID 102745301) has the molecular formula C12H18IN3O and a molecular weight of 347.20 g/mol. Its IUPAC name is 4-(5-iodopyrimidin-4-yl)-2,2,6,6-tetramethylmorpholine.
| Compound Name | 4-(5-iodopyrimidin-4-yl)-2,2,6,6-tetramethylmorpholine |
|---|---|
| PubChem CID | 102745301 |
| Molecular Formula | C12H18IN3O |
| Molecular Weight | 347.20 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 4-(5-iodopyrimidin-4-yl)-2,2,6,6-tetramethylmorpholine |
| SMILES | CC1(C)CN(c2ncncc2I)CC(C)(C)O1 |
| InChI | InChI=1S/C12H18IN3O/c1-11(2)6-16(7-12(3,4)17-11)10-9(13)5-14-8-15-10/h5,8H,6-7H2,1-4H3 |
| InChIKey | MFOISENDAPNWRA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.20 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|