About 1-[4-(5-iodopyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone
1-[4-(5-iodopyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone (PubChem CID 66320868) has the molecular formula C11H15IN4O
and a molecular weight of 346.17 g/mol. Its IUPAC name is 1-[4-(5-iodopyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-(5-iodopyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone |
| PubChem CID | 66320868 |
| Molecular Formula | C11H15IN4O |
| Molecular Weight | 346.17 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 1-[4-(5-iodopyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone |
| SMILES | CC(=O)N1CCCN(c2ncncc2I)CC1 |
| InChI | InChI=1S/C11H15IN4O/c1-9(17)15-3-2-4-16(6-5-15)11-10(12)7-13-8-14-11/h7-8H,2-6H2,1H3 |
| InChIKey | WBWWJFNYDAYKQI-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.17 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(5-iodopyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(5-iodopyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone?
The IUPAC name of 1-[4-(5-iodopyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone (CID 66320868) is 1-[4-(5-iodopyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone.
What is the SMILES notation for 1-[4-(5-iodopyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone?
The canonical SMILES for 1-[4-(5-iodopyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone is CC(=O)N1CCCN(c2ncncc2I)CC1.
What is the InChIKey of 1-[4-(5-iodopyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone?
The InChIKey is WBWWJFNYDAYKQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15IN4O/c1-9(17)15-3-2-4-16(6-5-15)11-10(12)7-13-8-14-11/h7-8H,2-6H2,1H3.
What are the key properties of 1-[4-(5-iodopyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone?
1-[4-(5-iodopyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone has a molecular weight of 346.17 g/mol, XLogP of 1.14, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(5-iodopyrimidin-4-yl)-1,4-diazepan-1-yl]ethanone is sourced from PubChem (CID 66320868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).