C15H22INO — CID 102745314
4-[(4-iodophenyl)methyl]-2,2,6,6-tetramethylmorpholine (PubChem CID 102745314) has the molecular formula C15H22INO and a molecular weight of 359.25 g/mol. Its IUPAC name is 4-[(4-iodophenyl)methyl]-2,2,6,6-tetramethylmorpholine.
| Compound Name | 4-[(4-iodophenyl)methyl]-2,2,6,6-tetramethylmorpholine |
|---|---|
| PubChem CID | 102745314 |
| Molecular Formula | C15H22INO |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 4-[(4-iodophenyl)methyl]-2,2,6,6-tetramethylmorpholine |
| SMILES | CC1(C)CN(Cc2ccc(I)cc2)CC(C)(C)O1 |
| InChI | InChI=1S/C15H22INO/c1-14(2)10-17(11-15(3,4)18-14)9-12-5-7-13(16)8-6-12/h5-8H,9-11H2,1-4H3 |
| InChIKey | XDCFQKCFDNJDGT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|