C13H19IN2O — CID 112750999
4-[(2,2-dimethylmorpholin-4-yl)methyl]-2-iodoaniline (PubChem CID 112750999) has the molecular formula C13H19IN2O and a molecular weight of 346.21 g/mol. Its IUPAC name is 4-[(2,2-dimethylmorpholin-4-yl)methyl]-2-iodoaniline.
| Compound Name | 4-[(2,2-dimethylmorpholin-4-yl)methyl]-2-iodoaniline |
|---|---|
| PubChem CID | 112750999 |
| Molecular Formula | C13H19IN2O |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 4-[(2,2-dimethylmorpholin-4-yl)methyl]-2-iodoaniline |
| SMILES | CC1(C)CN(Cc2ccc(N)c(I)c2)CCO1 |
| InChI | InChI=1S/C13H19IN2O/c1-13(2)9-16(5-6-17-13)8-10-3-4-12(15)11(14)7-10/h3-4,7H,5-6,8-9,15H2,1-2H3 |
| InChIKey | UGILWQVLLIEMHN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|