C11H16BrNOS — CID 86993054
4-[(5-bromothiophen-3-yl)methyl]-2,2-dimethylmorpholine (PubChem CID 86993054) has the molecular formula C11H16BrNOS and a molecular weight of 290.23 g/mol. Its IUPAC name is 4-[(5-bromothiophen-3-yl)methyl]-2,2-dimethylmorpholine.
| Compound Name | 4-[(5-bromothiophen-3-yl)methyl]-2,2-dimethylmorpholine |
|---|---|
| PubChem CID | 86993054 |
| Molecular Formula | C11H16BrNOS |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 4-[(5-bromothiophen-3-yl)methyl]-2,2-dimethylmorpholine |
| SMILES | CC1(C)CN(Cc2csc(Br)c2)CCO1 |
| InChI | InChI=1S/C11H16BrNOS/c1-11(2)8-13(3-4-14-11)6-9-5-10(12)15-7-9/h5,7H,3-4,6,8H2,1-2H3 |
| InChIKey | GXUPYYBUIOJJJW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |