C16H32N2O — CID 102746064
N-[4-(2,2,6,6-tetramethylmorpholin-4-yl)pentyl]cyclopropanamine (PubChem CID 102746064) has the molecular formula C16H32N2O and a molecular weight of 268.44 g/mol. Its IUPAC name is N-[4-(2,2,6,6-tetramethylmorpholin-4-yl)pentyl]cyclopropanamine.
| Compound Name | N-[4-(2,2,6,6-tetramethylmorpholin-4-yl)pentyl]cyclopropanamine |
|---|---|
| PubChem CID | 102746064 |
| Molecular Formula | C16H32N2O |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.25 |
| IUPAC Name | N-[4-(2,2,6,6-tetramethylmorpholin-4-yl)pentyl]cyclopropanamine |
| SMILES | CC(CCCNC1CC1)N1CC(C)(C)OC(C)(C)C1 |
| InChI | InChI=1S/C16H32N2O/c1-13(7-6-10-17-14-8-9-14)18-11-15(2,3)19-16(4,5)12-18/h13-14,17H,6-12H2,1-5H3 |
| InChIKey | HAKVWYMREHHGFJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|