C14H28N4O — CID 102746789
N-amino-N'-cyclopentyl-2,2,6,6-tetramethylmorpholine-4-carboximidamide (PubChem CID 102746789) has the molecular formula C14H28N4O and a molecular weight of 268.40 g/mol. Its IUPAC name is N-amino-N'-cyclopentyl-2,2,6,6-tetramethylmorpholine-4-carboximidamide.
| Compound Name | N-amino-N'-cyclopentyl-2,2,6,6-tetramethylmorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 102746789 |
| Molecular Formula | C14H28N4O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.23 |
| IUPAC Name | N-amino-N'-cyclopentyl-2,2,6,6-tetramethylmorpholine-4-carboximidamide |
| SMILES | CC1(C)CN(/C(=N/C2CCCC2)NN)CC(C)(C)O1 |
| InChI | InChI=1S/C14H28N4O/c1-13(2)9-18(10-14(3,4)19-13)12(17-15)16-11-7-5-6-8-11/h11H,5-10,15H2,1-4H3,(H,16,17) |
| InChIKey | SSLBGVLRARZEAN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|