C14H12F4N2O — CID 102747370
1-[4-[4-fluoro-3-(trifluoromethyl)phenoxy]-3-pyridinyl]-N-methylmethanamine (PubChem CID 102747370) has the molecular formula C14H12F4N2O and a molecular weight of 300.26 g/mol. Its IUPAC name is 1-[4-[4-fluoro-3-(trifluoromethyl)phenoxy]-3-pyridinyl]-N-methylmethanamine.
| Compound Name | 1-[4-[4-fluoro-3-(trifluoromethyl)phenoxy]-3-pyridinyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 102747370 |
| Molecular Formula | C14H12F4N2O |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 1-[4-[4-fluoro-3-(trifluoromethyl)phenoxy]-3-pyridinyl]-N-methylmethanamine |
| SMILES | CNCc1cnccc1Oc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H12F4N2O/c1-19-7-9-8-20-5-4-13(9)21-10-2-3-12(15)11(6-10)14(16,17)18/h2-6,8,19H,7H2,1H3 |
| InChIKey | DMZYSFLDTKNJIL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |