C16H15BrF3NOS — CID 23378651
1-[5-bromo-2-[4-methylsulfanyl-3-(trifluoromethyl)phenoxy]phenyl]-N-methylmethanamine (PubChem CID 23378651) has the molecular formula C16H15BrF3NOS and a molecular weight of 406.27 g/mol. Its IUPAC name is 1-[5-bromo-2-[4-methylsulfanyl-3-(trifluoromethyl)phenoxy]phenyl]-N-methylmethanamine.
| Compound Name | 1-[5-bromo-2-[4-methylsulfanyl-3-(trifluoromethyl)phenoxy]phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 23378651 |
| Molecular Formula | C16H15BrF3NOS |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 405.00 |
| IUPAC Name | 1-[5-bromo-2-[4-methylsulfanyl-3-(trifluoromethyl)phenoxy]phenyl]-N-methylmethanamine |
| SMILES | CNCc1cc(Br)ccc1Oc1ccc(SC)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H15BrF3NOS/c1-21-9-10-7-11(17)3-5-14(10)22-12-4-6-15(23-2)13(8-12)16(18,19)20/h3-8,21H,9H2,1-2H3 |
| InChIKey | AEAZHDLXKUPLRW-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |