C11H14F3NO4S2 — CID 102749110
methyl 4-methyl-3-(4,4,4-trifluorobutylsulfamoyl)thiophene-2-carboxylate (PubChem CID 102749110) has the molecular formula C11H14F3NO4S2 and a molecular weight of 345.36 g/mol. Its IUPAC name is methyl 4-methyl-3-(4,4,4-trifluorobutylsulfamoyl)thiophene-2-carboxylate.
| Compound Name | methyl 4-methyl-3-(4,4,4-trifluorobutylsulfamoyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 102749110 |
| Molecular Formula | C11H14F3NO4S2 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | methyl 4-methyl-3-(4,4,4-trifluorobutylsulfamoyl)thiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1S(=O)(=O)NCCCC(F)(F)F |
| InChI | InChI=1S/C11H14F3NO4S2/c1-7-6-20-8(10(16)19-2)9(7)21(17,18)15-5-3-4-11(12,13)14/h6,15H,3-5H2,1-2H3 |
| InChIKey | XUBXFGGKFSKJGX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|