C8H8F3NO4S2 — CID 18434574
ethyl 3-sulfamoyl-4-(trifluoromethyl)thiophene-2-carboxylate (PubChem CID 18434574) has the molecular formula C8H8F3NO4S2 and a molecular weight of 303.28 g/mol. Its IUPAC name is ethyl 3-sulfamoyl-4-(trifluoromethyl)thiophene-2-carboxylate.
| Compound Name | ethyl 3-sulfamoyl-4-(trifluoromethyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 18434574 |
| Molecular Formula | C8H8F3NO4S2 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 302.98 |
| IUPAC Name | ethyl 3-sulfamoyl-4-(trifluoromethyl)thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1scc(C(F)(F)F)c1S(N)(=O)=O |
| InChI | InChI=1S/C8H8F3NO4S2/c1-2-16-7(13)5-6(18(12,14)15)4(3-17-5)8(9,10)11/h3H,2H2,1H3,(H2,12,14,15) |
| InChIKey | SDBXVBMEHJENPD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |