C11H14F3NO4S2 — CID 102749111
4-methyl-3-(5,5,5-trifluoropentylsulfamoyl)thiophene-2-carboxylic acid (PubChem CID 102749111) has the molecular formula C11H14F3NO4S2 and a molecular weight of 345.36 g/mol. Its IUPAC name is 4-methyl-3-(5,5,5-trifluoropentylsulfamoyl)thiophene-2-carboxylic acid.
| Compound Name | 4-methyl-3-(5,5,5-trifluoropentylsulfamoyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 102749111 |
| Molecular Formula | C11H14F3NO4S2 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 4-methyl-3-(5,5,5-trifluoropentylsulfamoyl)thiophene-2-carboxylic acid |
| SMILES | Cc1csc(C(=O)O)c1S(=O)(=O)NCCCCC(F)(F)F |
| InChI | InChI=1S/C11H14F3NO4S2/c1-7-6-20-8(10(16)17)9(7)21(18,19)15-5-3-2-4-11(12,13)14/h6,15H,2-5H2,1H3,(H,16,17) |
| InChIKey | RXTVUKWRHALIPV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|