C14H21NO3S2 — CID 102750103
[3-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylsulfonyl)-4-methylthiophen-2-yl]methanol (PubChem CID 102750103) has the molecular formula C14H21NO3S2 and a molecular weight of 315.46 g/mol. Its IUPAC name is [3-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylsulfonyl)-4-methylthiophen-2-yl]methanol.
| Compound Name | [3-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylsulfonyl)-4-methylthiophen-2-yl]methanol |
|---|---|
| PubChem CID | 102750103 |
| Molecular Formula | C14H21NO3S2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | [3-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylsulfonyl)-4-methylthiophen-2-yl]methanol |
| SMILES | Cc1csc(CO)c1S(=O)(=O)N1CCCC2CCCC21 |
| InChI | InChI=1S/C14H21NO3S2/c1-10-9-19-13(8-16)14(10)20(17,18)15-7-3-5-11-4-2-6-12(11)15/h9,11-12,16H,2-8H2,1H3 |
| InChIKey | WFDLREQERBNWCA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |