C15H24N2O2S2 — CID 102751773
[3-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylsulfonyl)-4-methylthiophen-2-yl]methanamine (PubChem CID 102751773) has the molecular formula C15H24N2O2S2 and a molecular weight of 328.50 g/mol. Its IUPAC name is [3-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylsulfonyl)-4-methylthiophen-2-yl]methanamine.
| Compound Name | [3-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylsulfonyl)-4-methylthiophen-2-yl]methanamine |
|---|---|
| PubChem CID | 102751773 |
| Molecular Formula | C15H24N2O2S2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | [3-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylsulfonyl)-4-methylthiophen-2-yl]methanamine |
| SMILES | Cc1csc(CN)c1S(=O)(=O)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C15H24N2O2S2/c1-11-10-20-14(9-16)15(11)21(18,19)17-8-4-6-12-5-2-3-7-13(12)17/h10,12-13H,2-9,16H2,1H3 |
| InChIKey | MTECJKIPDIVQNA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |