C21H24ClF3N4O — CID 10275036
6-[2-chloro-4-(trifluoromethoxy)phenyl]-8-ethyl-9-heptan-3-ylpurine (PubChem CID 10275036) has the molecular formula C21H24ClF3N4O and a molecular weight of 440.90 g/mol. Its IUPAC name is 6-[2-chloro-4-(trifluoromethoxy)phenyl]-8-ethyl-9-heptan-3-ylpurine.
| Compound Name | 6-[2-chloro-4-(trifluoromethoxy)phenyl]-8-ethyl-9-heptan-3-ylpurine |
|---|---|
| PubChem CID | 10275036 |
| Molecular Formula | C21H24ClF3N4O |
| Molecular Weight | 440.90 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 6-[2-chloro-4-(trifluoromethoxy)phenyl]-8-ethyl-9-heptan-3-ylpurine |
| SMILES | CCCCC(CC)n1c(CC)nc2c(-c3ccc(OC(F)(F)F)cc3Cl)ncnc21 |
| InChI | InChI=1S/C21H24ClF3N4O/c1-4-7-8-13(5-2)29-17(6-3)28-19-18(26-12-27-20(19)29)15-10-9-14(11-16(15)22)30-21(23,24)25/h9-13H,4-8H2,1-3H3 |
| InChIKey | NIWHELUVNLEJHL-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.90 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |