C19H18Cl2N4 — CID 18001606
6-(2,4-dichlorophenyl)-8-ethyl-9-hex-1-yn-3-ylpurine (PubChem CID 18001606) has the molecular formula C19H18Cl2N4 and a molecular weight of 373.29 g/mol. Its IUPAC name is 6-(2,4-dichlorophenyl)-8-ethyl-9-hex-1-yn-3-ylpurine.
| Compound Name | 6-(2,4-dichlorophenyl)-8-ethyl-9-hex-1-yn-3-ylpurine |
|---|---|
| PubChem CID | 18001606 |
| Molecular Formula | C19H18Cl2N4 |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 6-(2,4-dichlorophenyl)-8-ethyl-9-hex-1-yn-3-ylpurine |
| SMILES | C#CC(CCC)n1c(CC)nc2c(-c3ccc(Cl)cc3Cl)ncnc21 |
| InChI | InChI=1S/C19H18Cl2N4/c1-4-7-13(5-2)25-16(6-3)24-18-17(22-11-23-19(18)25)14-9-8-12(20)10-15(14)21/h2,8-11,13H,4,6-7H2,1,3H3 |
| InChIKey | HNHMMHKDLKAOJD-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|