C20H18Cl2N4 — CID 70286594
9-(4-cyclopropylbut-2-ynyl)-6-(2,4-dichlorophenyl)-8-ethylpurine (PubChem CID 70286594) has the molecular formula C20H18Cl2N4 and a molecular weight of 385.30 g/mol. Its IUPAC name is 9-(4-cyclopropylbut-2-ynyl)-6-(2,4-dichlorophenyl)-8-ethylpurine.
| Compound Name | 9-(4-cyclopropylbut-2-ynyl)-6-(2,4-dichlorophenyl)-8-ethylpurine |
|---|---|
| PubChem CID | 70286594 |
| Molecular Formula | C20H18Cl2N4 |
| Molecular Weight | 385.30 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 9-(4-cyclopropylbut-2-ynyl)-6-(2,4-dichlorophenyl)-8-ethylpurine |
| SMILES | CCc1nc2c(-c3ccc(Cl)cc3Cl)ncnc2n1CC#CCC1CC1 |
| InChI | InChI=1S/C20H18Cl2N4/c1-2-17-25-19-18(15-9-8-14(21)11-16(15)22)23-12-24-20(19)26(17)10-4-3-5-13-6-7-13/h8-9,11-13H,2,5-7,10H2,1H3 |
| InChIKey | SSAMSDLMHQZOFT-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.30 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|