C22H25ClN4O — CID 18001462
6-(2-chloro-4-methoxy-5-methylphenyl)-9-(dicyclopropylmethyl)-8-ethylpurine (PubChem CID 18001462) has the molecular formula C22H25ClN4O and a molecular weight of 396.92 g/mol. Its IUPAC name is 6-(2-chloro-4-methoxy-5-methylphenyl)-9-(dicyclopropylmethyl)-8-ethylpurine.
| Compound Name | 6-(2-chloro-4-methoxy-5-methylphenyl)-9-(dicyclopropylmethyl)-8-ethylpurine |
|---|---|
| PubChem CID | 18001462 |
| Molecular Formula | C22H25ClN4O |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 6-(2-chloro-4-methoxy-5-methylphenyl)-9-(dicyclopropylmethyl)-8-ethylpurine |
| SMILES | CCc1nc2c(-c3cc(C)c(OC)cc3Cl)ncnc2n1C(C1CC1)C1CC1 |
| InChI | InChI=1S/C22H25ClN4O/c1-4-18-26-20-19(15-9-12(2)17(28-3)10-16(15)23)24-11-25-22(20)27(18)21(13-5-6-13)14-7-8-14/h9-11,13-14,21H,4-8H2,1-3H3 |
| InChIKey | BGMFGXOMEJYTLE-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |