C19H18ClF3N4 — CID 18001415
6-[4-chloro-2-(trifluoromethyl)phenyl]-9-(1-cyclopropylethyl)-8-ethylpurine (PubChem CID 18001415) has the molecular formula C19H18ClF3N4 and a molecular weight of 394.83 g/mol. Its IUPAC name is 6-[4-chloro-2-(trifluoromethyl)phenyl]-9-(1-cyclopropylethyl)-8-ethylpurine.
| Compound Name | 6-[4-chloro-2-(trifluoromethyl)phenyl]-9-(1-cyclopropylethyl)-8-ethylpurine |
|---|---|
| PubChem CID | 18001415 |
| Molecular Formula | C19H18ClF3N4 |
| Molecular Weight | 394.83 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 6-[4-chloro-2-(trifluoromethyl)phenyl]-9-(1-cyclopropylethyl)-8-ethylpurine |
| SMILES | CCc1nc2c(-c3ccc(Cl)cc3C(F)(F)F)ncnc2n1C(C)C1CC1 |
| InChI | InChI=1S/C19H18ClF3N4/c1-3-15-26-17-16(13-7-6-12(20)8-14(13)19(21,22)23)24-9-25-18(17)27(15)10(2)11-4-5-11/h6-11H,3-5H2,1-2H3 |
| InChIKey | UKOYHKIBNVQDPF-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.83 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |