C21H23F3N4O — CID 18001457
8-ethyl-9-hex-1-en-3-yl-6-[4-methoxy-2-(trifluoromethyl)phenyl]purine (PubChem CID 18001457) has the molecular formula C21H23F3N4O and a molecular weight of 404.44 g/mol. Its IUPAC name is 8-ethyl-9-hex-1-en-3-yl-6-[4-methoxy-2-(trifluoromethyl)phenyl]purine.
| Compound Name | 8-ethyl-9-hex-1-en-3-yl-6-[4-methoxy-2-(trifluoromethyl)phenyl]purine |
|---|---|
| PubChem CID | 18001457 |
| Molecular Formula | C21H23F3N4O |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 8-ethyl-9-hex-1-en-3-yl-6-[4-methoxy-2-(trifluoromethyl)phenyl]purine |
| SMILES | C=CC(CCC)n1c(CC)nc2c(-c3ccc(OC)cc3C(F)(F)F)ncnc21 |
| InChI | InChI=1S/C21H23F3N4O/c1-5-8-13(6-2)28-17(7-3)27-19-18(25-12-26-20(19)28)15-10-9-14(29-4)11-16(15)21(22,23)24/h6,9-13H,2,5,7-8H2,1,3-4H3 |
| InChIKey | SJAJFYIMZPGNJK-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|