C20H26F3N3O2 — CID 22249113
3-ethyl-6-methoxy-5-[4-methoxy-2-(trifluoromethyl)phenyl]-N-pentan-3-ylpyrazin-2-amine (PubChem CID 22249113) has the molecular formula C20H26F3N3O2 and a molecular weight of 397.44 g/mol. Its IUPAC name is 3-ethyl-6-methoxy-5-[4-methoxy-2-(trifluoromethyl)phenyl]-N-pentan-3-ylpyrazin-2-amine.
| Compound Name | 3-ethyl-6-methoxy-5-[4-methoxy-2-(trifluoromethyl)phenyl]-N-pentan-3-ylpyrazin-2-amine |
|---|---|
| PubChem CID | 22249113 |
| Molecular Formula | C20H26F3N3O2 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 3-ethyl-6-methoxy-5-[4-methoxy-2-(trifluoromethyl)phenyl]-N-pentan-3-ylpyrazin-2-amine |
| SMILES | CCc1nc(-c2ccc(OC)cc2C(F)(F)F)c(OC)nc1NC(CC)CC |
| InChI | InChI=1S/C20H26F3N3O2/c1-6-12(7-2)24-18-16(8-3)25-17(19(26-18)28-5)14-10-9-13(27-4)11-15(14)20(21,22)23/h9-12H,6-8H2,1-5H3,(H,24,26) |
| InChIKey | JGQRNOKIZSXROC-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |