C20H28ClN3O2 — CID 10293015
5-(4-chloro-2-ethoxyphenyl)-3-ethyl-6-methoxy-N-pentan-3-ylpyrazin-2-amine (PubChem CID 10293015) has the molecular formula C20H28ClN3O2 and a molecular weight of 377.92 g/mol. Its IUPAC name is 5-(4-chloro-2-ethoxyphenyl)-3-ethyl-6-methoxy-N-pentan-3-ylpyrazin-2-amine.
| Compound Name | 5-(4-chloro-2-ethoxyphenyl)-3-ethyl-6-methoxy-N-pentan-3-ylpyrazin-2-amine |
|---|---|
| PubChem CID | 10293015 |
| Molecular Formula | C20H28ClN3O2 |
| Molecular Weight | 377.92 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 5-(4-chloro-2-ethoxyphenyl)-3-ethyl-6-methoxy-N-pentan-3-ylpyrazin-2-amine |
| SMILES | CCOc1cc(Cl)ccc1-c1nc(CC)c(NC(CC)CC)nc1OC |
| InChI | InChI=1S/C20H28ClN3O2/c1-6-14(7-2)22-19-16(8-3)23-18(20(24-19)25-5)15-11-10-13(21)12-17(15)26-9-4/h10-12,14H,6-9H2,1-5H3,(H,22,24) |
| InChIKey | QCMYXKUBVFZJBM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.92 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |