About 5-(3,5-dichlorothiophen-2-yl)-6-ethyl-3-methoxy-N-pentan-3-ylpyrazin-2-amine
5-(3,5-dichlorothiophen-2-yl)-6-ethyl-3-methoxy-N-pentan-3-ylpyrazin-2-amine (PubChem CID 23595026) has the molecular formula C16H21Cl2N3OS
and a molecular weight of 374.34 g/mol. Its IUPAC name is 5-(3,5-dichlorothiophen-2-yl)-6-ethyl-3-methoxy-N-pentan-3-ylpyrazin-2-amine.
Molecular Properties
| Compound Name | 5-(3,5-dichlorothiophen-2-yl)-6-ethyl-3-methoxy-N-pentan-3-ylpyrazin-2-amine |
| PubChem CID | 23595026 |
| Molecular Formula | C16H21Cl2N3OS |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 5-(3,5-dichlorothiophen-2-yl)-6-ethyl-3-methoxy-N-pentan-3-ylpyrazin-2-amine |
| SMILES | CCc1nc(NC(CC)CC)c(OC)nc1-c1sc(Cl)cc1Cl |
| InChI | InChI=1S/C16H21Cl2N3OS/c1-5-9(6-2)19-15-16(22-4)21-13(11(7-3)20-15)14-10(17)8-12(18)23-14/h8-9H,5-7H2,1-4H3,(H,19,20) |
| InChIKey | AJEYFPGDVJOVLI-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(3,5-dichlorothiophen-2-yl)-6-ethyl-3-methoxy-N-pentan-3-ylpyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,5-dichlorothiophen-2-yl)-6-ethyl-3-methoxy-N-pentan-3-ylpyrazin-2-amine?
The IUPAC name of 5-(3,5-dichlorothiophen-2-yl)-6-ethyl-3-methoxy-N-pentan-3-ylpyrazin-2-amine (CID 23595026) is 5-(3,5-dichlorothiophen-2-yl)-6-ethyl-3-methoxy-N-pentan-3-ylpyrazin-2-amine.
What is the SMILES notation for 5-(3,5-dichlorothiophen-2-yl)-6-ethyl-3-methoxy-N-pentan-3-ylpyrazin-2-amine?
The canonical SMILES for 5-(3,5-dichlorothiophen-2-yl)-6-ethyl-3-methoxy-N-pentan-3-ylpyrazin-2-amine is CCc1nc(NC(CC)CC)c(OC)nc1-c1sc(Cl)cc1Cl.
What is the InChIKey of 5-(3,5-dichlorothiophen-2-yl)-6-ethyl-3-methoxy-N-pentan-3-ylpyrazin-2-amine?
The InChIKey is AJEYFPGDVJOVLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21Cl2N3OS/c1-5-9(6-2)19-15-16(22-4)21-13(11(7-3)20-15)14-10(17)8-12(18)23-14/h8-9H,5-7H2,1-4H3,(H,19,20).
What are the key properties of 5-(3,5-dichlorothiophen-2-yl)-6-ethyl-3-methoxy-N-pentan-3-ylpyrazin-2-amine?
5-(3,5-dichlorothiophen-2-yl)-6-ethyl-3-methoxy-N-pentan-3-ylpyrazin-2-amine has a molecular weight of 374.34 g/mol, XLogP of 5.68, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,5-dichlorothiophen-2-yl)-6-ethyl-3-methoxy-N-pentan-3-ylpyrazin-2-amine is sourced from PubChem (CID 23595026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).