C11H18BN3O — CID 89020511
CID 89020511 (PubChem CID 89020511) has the molecular formula C11H18BN3O and a molecular weight of 219.10 g/mol.
| Compound Name | CID 89020511 |
|---|---|
| PubChem CID | 89020511 |
| Molecular Formula | C11H18BN3O |
| Molecular Weight | 219.10 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | — |
| SMILES | [B]c1cc(N)c(NC(CC)CC)nc1OC |
| InChI | InChI=1S/C11H18BN3O/c1-4-7(5-2)14-10-9(13)6-8(12)11(15-10)16-3/h6-7H,4-5,13H2,1-3H3,(H,14,15) |
| InChIKey | HJDNMLZHDIJDCU-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.10 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|