C16H22F3NO — CID 102751951
2-[2-methyl-4-(trifluoromethyl)phenyl]-1-piperidin-2-ylpropan-2-ol (PubChem CID 102751951) has the molecular formula C16H22F3NO and a molecular weight of 301.35 g/mol. Its IUPAC name is 2-[2-methyl-4-(trifluoromethyl)phenyl]-1-piperidin-2-ylpropan-2-ol.
| Compound Name | 2-[2-methyl-4-(trifluoromethyl)phenyl]-1-piperidin-2-ylpropan-2-ol |
|---|---|
| PubChem CID | 102751951 |
| Molecular Formula | C16H22F3NO |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 2-[2-methyl-4-(trifluoromethyl)phenyl]-1-piperidin-2-ylpropan-2-ol |
| SMILES | Cc1cc(C(F)(F)F)ccc1C(C)(O)CC1CCCCN1 |
| InChI | InChI=1S/C16H22F3NO/c1-11-9-12(16(17,18)19)6-7-14(11)15(2,21)10-13-5-3-4-8-20-13/h6-7,9,13,20-21H,3-5,8,10H2,1-2H3 |
| InChIKey | QOGUONQQTLFPAI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |