C13H15F4N — CID 116840282
2-[2-(2,4-difluorophenyl)-2,2-difluoroethyl]piperidine (PubChem CID 116840282) has the molecular formula C13H15F4N and a molecular weight of 261.26 g/mol. Its IUPAC name is 2-[2-(2,4-difluorophenyl)-2,2-difluoroethyl]piperidine.
| Compound Name | 2-[2-(2,4-difluorophenyl)-2,2-difluoroethyl]piperidine |
|---|---|
| PubChem CID | 116840282 |
| Molecular Formula | C13H15F4N |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 2-[2-(2,4-difluorophenyl)-2,2-difluoroethyl]piperidine |
| SMILES | Fc1ccc(C(F)(F)CC2CCCCN2)c(F)c1 |
| InChI | InChI=1S/C13H15F4N/c14-9-4-5-11(12(15)7-9)13(16,17)8-10-3-1-2-6-18-10/h4-5,7,10,18H,1-3,6,8H2 |
| InChIKey | NVYOYRPZZCRSHG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |