C13H16BrF2N — CID 116840165
2-[2-(5-bromo-2-methylphenyl)-2,2-difluoroethyl]pyrrolidine (PubChem CID 116840165) has the molecular formula C13H16BrF2N and a molecular weight of 304.18 g/mol. Its IUPAC name is 2-[2-(5-bromo-2-methylphenyl)-2,2-difluoroethyl]pyrrolidine.
| Compound Name | 2-[2-(5-bromo-2-methylphenyl)-2,2-difluoroethyl]pyrrolidine |
|---|---|
| PubChem CID | 116840165 |
| Molecular Formula | C13H16BrF2N |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 2-[2-(5-bromo-2-methylphenyl)-2,2-difluoroethyl]pyrrolidine |
| SMILES | Cc1ccc(Br)cc1C(F)(F)CC1CCCN1 |
| InChI | InChI=1S/C13H16BrF2N/c1-9-4-5-10(14)7-12(9)13(15,16)8-11-3-2-6-17-11/h4-5,7,11,17H,2-3,6,8H2,1H3 |
| InChIKey | YRXDRGGAQATMGF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |