C17H27BrN2 — CID 115210512
2-(5-bromo-2-methylphenyl)-2-methyl-N-(2-pyrrolidin-2-ylethyl)propan-1-amine (PubChem CID 115210512) has the molecular formula C17H27BrN2 and a molecular weight of 339.32 g/mol. Its IUPAC name is 2-(5-bromo-2-methylphenyl)-2-methyl-N-(2-pyrrolidin-2-ylethyl)propan-1-amine.
| Compound Name | 2-(5-bromo-2-methylphenyl)-2-methyl-N-(2-pyrrolidin-2-ylethyl)propan-1-amine |
|---|---|
| PubChem CID | 115210512 |
| Molecular Formula | C17H27BrN2 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 2-(5-bromo-2-methylphenyl)-2-methyl-N-(2-pyrrolidin-2-ylethyl)propan-1-amine |
| SMILES | Cc1ccc(Br)cc1C(C)(C)CNCCC1CCCN1 |
| InChI | InChI=1S/C17H27BrN2/c1-13-6-7-14(18)11-16(13)17(2,3)12-19-10-8-15-5-4-9-20-15/h6-7,11,15,19-20H,4-5,8-10,12H2,1-3H3 |
| InChIKey | UXUMTTOGNXGAMG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|