C14H20BrNO2 — CID 115218391
3-[[2-(5-bromo-2-methylphenyl)-2-methylpropyl]amino]propanoic acid (PubChem CID 115218391) has the molecular formula C14H20BrNO2 and a molecular weight of 314.22 g/mol. Its IUPAC name is 3-[[2-(5-bromo-2-methylphenyl)-2-methylpropyl]amino]propanoic acid.
| Compound Name | 3-[[2-(5-bromo-2-methylphenyl)-2-methylpropyl]amino]propanoic acid |
|---|---|
| PubChem CID | 115218391 |
| Molecular Formula | C14H20BrNO2 |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 3-[[2-(5-bromo-2-methylphenyl)-2-methylpropyl]amino]propanoic acid |
| SMILES | Cc1ccc(Br)cc1C(C)(C)CNCCC(=O)O |
| InChI | InChI=1S/C14H20BrNO2/c1-10-4-5-11(15)8-12(10)14(2,3)9-16-7-6-13(17)18/h4-5,8,16H,6-7,9H2,1-3H3,(H,17,18) |
| InChIKey | XTQRUWVKZTZKGR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|