C11H14BrF2NS — CID 116840275
2-[2-(5-bromothiophen-2-yl)-2,2-difluoroethyl]piperidine (PubChem CID 116840275) has the molecular formula C11H14BrF2NS and a molecular weight of 310.21 g/mol. Its IUPAC name is 2-[2-(5-bromothiophen-2-yl)-2,2-difluoroethyl]piperidine.
| Compound Name | 2-[2-(5-bromothiophen-2-yl)-2,2-difluoroethyl]piperidine |
|---|---|
| PubChem CID | 116840275 |
| Molecular Formula | C11H14BrF2NS |
| Molecular Weight | 310.21 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | 2-[2-(5-bromothiophen-2-yl)-2,2-difluoroethyl]piperidine |
| SMILES | FC(F)(CC1CCCCN1)c1ccc(Br)s1 |
| InChI | InChI=1S/C11H14BrF2NS/c12-10-5-4-9(16-10)11(13,14)7-8-3-1-2-6-15-8/h4-5,8,15H,1-3,6-7H2 |
| InChIKey | QDZFYBQJMLSBBZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.21 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |