C15H25BrN2S — CID 106623215
N-[1-(5-bromothiophen-2-yl)ethyl]-N-(piperidin-2-ylmethyl)propan-1-amine (PubChem CID 106623215) has the molecular formula C15H25BrN2S and a molecular weight of 345.35 g/mol. Its IUPAC name is N-[1-(5-bromothiophen-2-yl)ethyl]-N-(piperidin-2-ylmethyl)propan-1-amine.
| Compound Name | N-[1-(5-bromothiophen-2-yl)ethyl]-N-(piperidin-2-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 106623215 |
| Molecular Formula | C15H25BrN2S |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | N-[1-(5-bromothiophen-2-yl)ethyl]-N-(piperidin-2-ylmethyl)propan-1-amine |
| SMILES | CCCN(CC1CCCCN1)C(C)c1ccc(Br)s1 |
| InChI | InChI=1S/C15H25BrN2S/c1-3-10-18(11-13-6-4-5-9-17-13)12(2)14-7-8-15(16)19-14/h7-8,12-13,17H,3-6,9-11H2,1-2H3 |
| InChIKey | JPRFBKROZWTAEV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |