C15H25ClN2S — CID 106604631
N-[1-(5-chlorothiophen-2-yl)ethyl]-N-(pyrrolidin-2-ylmethyl)butan-1-amine (PubChem CID 106604631) has the molecular formula C15H25ClN2S and a molecular weight of 300.90 g/mol. Its IUPAC name is N-[1-(5-chlorothiophen-2-yl)ethyl]-N-(pyrrolidin-2-ylmethyl)butan-1-amine.
| Compound Name | N-[1-(5-chlorothiophen-2-yl)ethyl]-N-(pyrrolidin-2-ylmethyl)butan-1-amine |
|---|---|
| PubChem CID | 106604631 |
| Molecular Formula | C15H25ClN2S |
| Molecular Weight | 300.90 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | N-[1-(5-chlorothiophen-2-yl)ethyl]-N-(pyrrolidin-2-ylmethyl)butan-1-amine |
| SMILES | CCCCN(CC1CCCN1)C(C)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H25ClN2S/c1-3-4-10-18(11-13-6-5-9-17-13)12(2)14-7-8-15(16)19-14/h7-8,12-13,17H,3-6,9-11H2,1-2H3 |
| InChIKey | YMOGLFCCZFQTBN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.90 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |