C17H15F4NO — CID 123504254
bis(2,4-difluorophenyl)-pyrrolidin-2-ylmethanol (PubChem CID 123504254) has the molecular formula C17H15F4NO and a molecular weight of 325.31 g/mol. Its IUPAC name is bis(2,4-difluorophenyl)-pyrrolidin-2-ylmethanol.
| Compound Name | bis(2,4-difluorophenyl)-pyrrolidin-2-ylmethanol |
|---|---|
| PubChem CID | 123504254 |
| Molecular Formula | C17H15F4NO |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | bis(2,4-difluorophenyl)-pyrrolidin-2-ylmethanol |
| SMILES | OC(c1ccc(F)cc1F)(c1ccc(F)cc1F)C1CCCN1 |
| InChI | InChI=1S/C17H15F4NO/c18-10-3-5-12(14(20)8-10)17(23,16-2-1-7-22-16)13-6-4-11(19)9-15(13)21/h3-6,8-9,16,22-23H,1-2,7H2 |
| InChIKey | GEBHILKIJGENBQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |