C11H4Cl3F3N2S — CID 102752250
2,3,5-trichloro-6-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]pyridine (PubChem CID 102752250) has the molecular formula C11H4Cl3F3N2S and a molecular weight of 359.59 g/mol. Its IUPAC name is 2,3,5-trichloro-6-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]pyridine.
| Compound Name | 2,3,5-trichloro-6-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]pyridine |
|---|---|
| PubChem CID | 102752250 |
| Molecular Formula | C11H4Cl3F3N2S |
| Molecular Weight | 359.59 g/mol |
| Exact Mass | 357.91 |
| IUPAC Name | 2,3,5-trichloro-6-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]pyridine |
| SMILES | FC(F)(F)c1ccc(Sc2nc(Cl)c(Cl)cc2Cl)nc1 |
| InChI | InChI=1S/C11H4Cl3F3N2S/c12-6-3-7(13)10(19-9(6)14)20-8-2-1-5(4-18-8)11(15,16)17/h1-4H |
| InChIKey | YEQYGHODVGQWGU-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.59 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|