C15H14Cl3NS — CID 102752274
2-(4-tert-butylphenyl)sulfanyl-3,5,6-trichloropyridine (PubChem CID 102752274) has the molecular formula C15H14Cl3NS and a molecular weight of 346.71 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)sulfanyl-3,5,6-trichloropyridine.
| Compound Name | 2-(4-tert-butylphenyl)sulfanyl-3,5,6-trichloropyridine |
|---|---|
| PubChem CID | 102752274 |
| Molecular Formula | C15H14Cl3NS |
| Molecular Weight | 346.71 g/mol |
| Exact Mass | 344.99 |
| IUPAC Name | 2-(4-tert-butylphenyl)sulfanyl-3,5,6-trichloropyridine |
| SMILES | CC(C)(C)c1ccc(Sc2nc(Cl)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C15H14Cl3NS/c1-15(2,3)9-4-6-10(7-5-9)20-14-12(17)8-11(16)13(18)19-14/h4-8H,1-3H3 |
| InChIKey | FHTCAYWZHJFICA-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.71 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|