C7H6Cl3NS — CID 102752225
2,3,5-trichloro-6-ethylsulfanylpyridine (PubChem CID 102752225) has the molecular formula C7H6Cl3NS and a molecular weight of 242.56 g/mol. Its IUPAC name is 2,3,5-trichloro-6-ethylsulfanylpyridine.
| Compound Name | 2,3,5-trichloro-6-ethylsulfanylpyridine |
|---|---|
| PubChem CID | 102752225 |
| Molecular Formula | C7H6Cl3NS |
| Molecular Weight | 242.56 g/mol |
| Exact Mass | 240.93 |
| IUPAC Name | 2,3,5-trichloro-6-ethylsulfanylpyridine |
| SMILES | CCSc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C7H6Cl3NS/c1-2-12-7-5(9)3-4(8)6(10)11-7/h3H,2H2,1H3 |
| InChIKey | LKMSTTSFRKFJRZ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.56 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|