C6H8ClN3S — CID 80888466
5-chloro-4-ethylsulfanylpyrimidin-2-amine (PubChem CID 80888466) has the molecular formula C6H8ClN3S and a molecular weight of 189.67 g/mol. Its IUPAC name is 5-chloro-4-ethylsulfanylpyrimidin-2-amine.
| Compound Name | 5-chloro-4-ethylsulfanylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80888466 |
| Molecular Formula | C6H8ClN3S |
| Molecular Weight | 189.67 g/mol |
| Exact Mass | 189.01 |
| IUPAC Name | 5-chloro-4-ethylsulfanylpyrimidin-2-amine |
| SMILES | CCSc1nc(N)ncc1Cl |
| InChI | InChI=1S/C6H8ClN3S/c1-2-11-5-4(7)3-9-6(8)10-5/h3H,2H2,1H3,(H2,8,9,10) |
| InChIKey | OWYYVGBXDLMXLR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.67 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |