C10H14Cl2N2S — CID 107765860
3,5-dichloro-6-(3-methylbutylsulfanyl)pyridin-2-amine (PubChem CID 107765860) has the molecular formula C10H14Cl2N2S and a molecular weight of 265.21 g/mol. Its IUPAC name is 3,5-dichloro-6-(3-methylbutylsulfanyl)pyridin-2-amine.
| Compound Name | 3,5-dichloro-6-(3-methylbutylsulfanyl)pyridin-2-amine |
|---|---|
| PubChem CID | 107765860 |
| Molecular Formula | C10H14Cl2N2S |
| Molecular Weight | 265.21 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 3,5-dichloro-6-(3-methylbutylsulfanyl)pyridin-2-amine |
| SMILES | CC(C)CCSc1nc(N)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H14Cl2N2S/c1-6(2)3-4-15-10-8(12)5-7(11)9(13)14-10/h5-6H,3-4H2,1-2H3,(H2,13,14) |
| InChIKey | IZQOHWDXGTXWPS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.21 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |