C6H6Cl2N2S — CID 102761414
3,5-dichloro-6-methylsulfanylpyridin-2-amine (PubChem CID 102761414) has the molecular formula C6H6Cl2N2S and a molecular weight of 209.10 g/mol. Its IUPAC name is 3,5-dichloro-6-methylsulfanylpyridin-2-amine.
| Compound Name | 3,5-dichloro-6-methylsulfanylpyridin-2-amine |
|---|---|
| PubChem CID | 102761414 |
| Molecular Formula | C6H6Cl2N2S |
| Molecular Weight | 209.10 g/mol |
| Exact Mass | 207.96 |
| IUPAC Name | 3,5-dichloro-6-methylsulfanylpyridin-2-amine |
| SMILES | CSc1nc(N)c(Cl)cc1Cl |
| InChI | InChI=1S/C6H6Cl2N2S/c1-11-6-4(8)2-3(7)5(9)10-6/h2H,1H3,(H2,9,10) |
| InChIKey | OMLWRDKGSJBALA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.10 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |