C29H35NO3 — CID 10275387
3,3-bis[3-(cyclopentylidenemethyl)-4-methoxyphenyl]propanamide (PubChem CID 10275387) has the molecular formula C29H35NO3 and a molecular weight of 445.60 g/mol. Its IUPAC name is 3,3-bis[3-(cyclopentylidenemethyl)-4-methoxyphenyl]propanamide.
| Compound Name | 3,3-bis[3-(cyclopentylidenemethyl)-4-methoxyphenyl]propanamide |
|---|---|
| PubChem CID | 10275387 |
| Molecular Formula | C29H35NO3 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | 3,3-bis[3-(cyclopentylidenemethyl)-4-methoxyphenyl]propanamide |
| SMILES | COc1ccc(C(CC(N)=O)c2ccc(OC)c(C=C3CCCC3)c2)cc1C=C1CCCC1 |
| InChI | InChI=1S/C29H35NO3/c1-32-27-13-11-22(17-24(27)15-20-7-3-4-8-20)26(19-29(30)31)23-12-14-28(33-2)25(18-23)16-21-9-5-6-10-21/h11-18,26H,3-10,19H2,1-2H3,(H2,30,31) |
| InChIKey | GRNWSMXWHCCTSH-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |