C24H25NO3 — CID 54470630
3-[3-(cyclopentylidenemethyl)-4-methoxyphenyl]-3-(3,4-dimethoxyphenyl)prop-2-enenitrile (PubChem CID 54470630) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is 3-[3-(cyclopentylidenemethyl)-4-methoxyphenyl]-3-(3,4-dimethoxyphenyl)prop-2-enenitrile.
| Compound Name | 3-[3-(cyclopentylidenemethyl)-4-methoxyphenyl]-3-(3,4-dimethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 54470630 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 3-[3-(cyclopentylidenemethyl)-4-methoxyphenyl]-3-(3,4-dimethoxyphenyl)prop-2-enenitrile |
| SMILES | COc1ccc(C(=CC#N)c2ccc(OC)c(OC)c2)cc1C=C1CCCC1 |
| InChI | InChI=1S/C24H25NO3/c1-26-22-10-8-18(15-20(22)14-17-6-4-5-7-17)21(12-13-25)19-9-11-23(27-2)24(16-19)28-3/h8-12,14-16H,4-7H2,1-3H3 |
| InChIKey | XICGEZVRCXIGHN-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|