C15H28N2O2S2 — CID 102754332
2-(aminomethyl)-4-methyl-N-(2-methylpropyl)-N-pentan-3-ylthiophene-3-sulfonamide (PubChem CID 102754332) has the molecular formula C15H28N2O2S2 and a molecular weight of 332.54 g/mol. Its IUPAC name is 2-(aminomethyl)-4-methyl-N-(2-methylpropyl)-N-pentan-3-ylthiophene-3-sulfonamide.
| Compound Name | 2-(aminomethyl)-4-methyl-N-(2-methylpropyl)-N-pentan-3-ylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 102754332 |
| Molecular Formula | C15H28N2O2S2 |
| Molecular Weight | 332.54 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 2-(aminomethyl)-4-methyl-N-(2-methylpropyl)-N-pentan-3-ylthiophene-3-sulfonamide |
| SMILES | CCC(CC)N(CC(C)C)S(=O)(=O)c1c(C)csc1CN |
| InChI | InChI=1S/C15H28N2O2S2/c1-6-13(7-2)17(9-11(3)4)21(18,19)15-12(5)10-20-14(15)8-16/h10-11,13H,6-9,16H2,1-5H3 |
| InChIKey | KCNBEMRPHNFSSX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |