C14H26N2O2S2 — CID 102751342
N-ethyl-4-methyl-N-propan-2-yl-2-[(propan-2-ylamino)methyl]thiophene-3-sulfonamide (PubChem CID 102751342) has the molecular formula C14H26N2O2S2 and a molecular weight of 318.51 g/mol. Its IUPAC name is N-ethyl-4-methyl-N-propan-2-yl-2-[(propan-2-ylamino)methyl]thiophene-3-sulfonamide.
| Compound Name | N-ethyl-4-methyl-N-propan-2-yl-2-[(propan-2-ylamino)methyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 102751342 |
| Molecular Formula | C14H26N2O2S2 |
| Molecular Weight | 318.51 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N-ethyl-4-methyl-N-propan-2-yl-2-[(propan-2-ylamino)methyl]thiophene-3-sulfonamide |
| SMILES | CCN(C(C)C)S(=O)(=O)c1c(C)csc1CNC(C)C |
| InChI | InChI=1S/C14H26N2O2S2/c1-7-16(11(4)5)20(17,18)14-12(6)9-19-13(14)8-15-10(2)3/h9-11,15H,7-8H2,1-6H3 |
| InChIKey | JJPMFSPGPASMEX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.51 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |