C15H24N2O2S2 — CID 102754819
2-[(cyclopropylamino)methyl]-N-(2-cyclopropylpropyl)-4-methylthiophene-3-sulfonamide (PubChem CID 102754819) has the molecular formula C15H24N2O2S2 and a molecular weight of 328.50 g/mol. Its IUPAC name is 2-[(cyclopropylamino)methyl]-N-(2-cyclopropylpropyl)-4-methylthiophene-3-sulfonamide.
| Compound Name | 2-[(cyclopropylamino)methyl]-N-(2-cyclopropylpropyl)-4-methylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 102754819 |
| Molecular Formula | C15H24N2O2S2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 2-[(cyclopropylamino)methyl]-N-(2-cyclopropylpropyl)-4-methylthiophene-3-sulfonamide |
| SMILES | Cc1csc(CNC2CC2)c1S(=O)(=O)NCC(C)C1CC1 |
| InChI | InChI=1S/C15H24N2O2S2/c1-10(12-3-4-12)7-17-21(18,19)15-11(2)9-20-14(15)8-16-13-5-6-13/h9-10,12-13,16-17H,3-8H2,1-2H3 |
| InChIKey | PHTZVABBNPBWHR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |