C13H18N4O2S2 — CID 106069710
2-[(cyclopropylamino)methyl]-N-(1H-imidazol-5-ylmethyl)-4-methylthiophene-3-sulfonamide (PubChem CID 106069710) has the molecular formula C13H18N4O2S2 and a molecular weight of 326.45 g/mol. Its IUPAC name is 2-[(cyclopropylamino)methyl]-N-(1H-imidazol-5-ylmethyl)-4-methylthiophene-3-sulfonamide.
| Compound Name | 2-[(cyclopropylamino)methyl]-N-(1H-imidazol-5-ylmethyl)-4-methylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106069710 |
| Molecular Formula | C13H18N4O2S2 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2-[(cyclopropylamino)methyl]-N-(1H-imidazol-5-ylmethyl)-4-methylthiophene-3-sulfonamide |
| SMILES | Cc1csc(CNC2CC2)c1S(=O)(=O)NCc1cnc[nH]1 |
| InChI | InChI=1S/C13H18N4O2S2/c1-9-7-20-12(6-15-10-2-3-10)13(9)21(18,19)17-5-11-4-14-8-16-11/h4,7-8,10,15,17H,2-3,5-6H2,1H3,(H,14,16) |
| InChIKey | OBSTWNRFMBHPSE-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |