C13H22N2O2S3 — CID 102754929
N-[[4-methyl-3-(2-methylthiomorpholin-4-yl)sulfonylthiophen-2-yl]methyl]ethanamine (PubChem CID 102754929) has the molecular formula C13H22N2O2S3 and a molecular weight of 334.53 g/mol. Its IUPAC name is N-[[4-methyl-3-(2-methylthiomorpholin-4-yl)sulfonylthiophen-2-yl]methyl]ethanamine.
| Compound Name | N-[[4-methyl-3-(2-methylthiomorpholin-4-yl)sulfonylthiophen-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 102754929 |
| Molecular Formula | C13H22N2O2S3 |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | N-[[4-methyl-3-(2-methylthiomorpholin-4-yl)sulfonylthiophen-2-yl]methyl]ethanamine |
| SMILES | CCNCc1scc(C)c1S(=O)(=O)N1CCSC(C)C1 |
| InChI | InChI=1S/C13H22N2O2S3/c1-4-14-7-12-13(10(2)9-19-12)20(16,17)15-5-6-18-11(3)8-15/h9,11,14H,4-8H2,1-3H3 |
| InChIKey | AERBZLZVXPNUTA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |