C15H26N2O2S2 — CID 102754369
N-[[3-(3,3-dimethylpyrrolidin-1-yl)sulfonyl-4-methylthiophen-2-yl]methyl]propan-1-amine (PubChem CID 102754369) has the molecular formula C15H26N2O2S2 and a molecular weight of 330.52 g/mol. Its IUPAC name is N-[[3-(3,3-dimethylpyrrolidin-1-yl)sulfonyl-4-methylthiophen-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[3-(3,3-dimethylpyrrolidin-1-yl)sulfonyl-4-methylthiophen-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 102754369 |
| Molecular Formula | C15H26N2O2S2 |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | N-[[3-(3,3-dimethylpyrrolidin-1-yl)sulfonyl-4-methylthiophen-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1scc(C)c1S(=O)(=O)N1CCC(C)(C)C1 |
| InChI | InChI=1S/C15H26N2O2S2/c1-5-7-16-9-13-14(12(2)10-20-13)21(18,19)17-8-6-15(3,4)11-17/h10,16H,5-9,11H2,1-4H3 |
| InChIKey | VGKZMARUFCZUSQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|