C17H24F3N — CID 102756361
2-[2-methyl-4-(trifluoromethyl)phenyl]-4-propan-2-ylcyclohexan-1-amine (PubChem CID 102756361) has the molecular formula C17H24F3N and a molecular weight of 299.38 g/mol. Its IUPAC name is 2-[2-methyl-4-(trifluoromethyl)phenyl]-4-propan-2-ylcyclohexan-1-amine.
| Compound Name | 2-[2-methyl-4-(trifluoromethyl)phenyl]-4-propan-2-ylcyclohexan-1-amine |
|---|---|
| PubChem CID | 102756361 |
| Molecular Formula | C17H24F3N |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 2-[2-methyl-4-(trifluoromethyl)phenyl]-4-propan-2-ylcyclohexan-1-amine |
| SMILES | Cc1cc(C(F)(F)F)ccc1C1CC(C(C)C)CCC1N |
| InChI | InChI=1S/C17H24F3N/c1-10(2)12-4-7-16(21)15(9-12)14-6-5-13(8-11(14)3)17(18,19)20/h5-6,8,10,12,15-16H,4,7,9,21H2,1-3H3 |
| InChIKey | BRFASSOFNSALIZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |